C23H23BrN4O — CID 25301822
N-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-bromobenzamide (PubChem CID 25301822) has the molecular formula C23H23BrN4O and a molecular weight of 451.37 g/mol. Its IUPAC name is N-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-bromobenzamide.
| Compound Name | N-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-bromobenzamide |
|---|---|
| PubChem CID | 25301822 |
| Molecular Formula | C23H23BrN4O |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | N-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-3-bromobenzamide |
| SMILES | O=C(Nc1cccc(-c2ccc(N3CCCCCC3)nn2)c1)c1cccc(Br)c1 |
| InChI | InChI=1S/C23H23BrN4O/c24-19-9-5-8-18(15-19)23(29)25-20-10-6-7-17(16-20)21-11-12-22(27-26-21)28-13-3-1-2-4-14-28/h5-12,15-16H,1-4,13-14H2,(H,25,29) |
| InChIKey | UOKDYIQYAPZIDG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |