C23H23F3N6O — CID 43992106
1-[3-[6-(4-methylpiperazin-1-yl)pyridazin-3-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 43992106) has the molecular formula C23H23F3N6O and a molecular weight of 456.47 g/mol. Its IUPAC name is 1-[3-[6-(4-methylpiperazin-1-yl)pyridazin-3-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-[6-(4-methylpiperazin-1-yl)pyridazin-3-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 43992106 |
| Molecular Formula | C23H23F3N6O |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 1-[3-[6-(4-methylpiperazin-1-yl)pyridazin-3-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CN1CCN(c2ccc(-c3cccc(NC(=O)Nc4cccc(C(F)(F)F)c4)c3)nn2)CC1 |
| InChI | InChI=1S/C23H23F3N6O/c1-31-10-12-32(13-11-31)21-9-8-20(29-30-21)16-4-2-6-18(14-16)27-22(33)28-19-7-3-5-17(15-19)23(24,25)26/h2-9,14-15H,10-13H2,1H3,(H2,27,28,33) |
| InChIKey | SVXIPJTYOCWUNO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |