C24H26FN5O2 — CID 43992084
2-(3-fluorophenoxy)-N-[3-[6-(4-methylpiperazin-1-yl)pyridazin-3-yl]phenyl]propanamide (PubChem CID 43992084) has the molecular formula C24H26FN5O2 and a molecular weight of 435.50 g/mol. Its IUPAC name is 2-(3-fluorophenoxy)-N-[3-[6-(4-methylpiperazin-1-yl)pyridazin-3-yl]phenyl]propanamide.
| Compound Name | 2-(3-fluorophenoxy)-N-[3-[6-(4-methylpiperazin-1-yl)pyridazin-3-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 43992084 |
| Molecular Formula | C24H26FN5O2 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 2-(3-fluorophenoxy)-N-[3-[6-(4-methylpiperazin-1-yl)pyridazin-3-yl]phenyl]propanamide |
| SMILES | CC(Oc1cccc(F)c1)C(=O)Nc1cccc(-c2ccc(N3CCN(C)CC3)nn2)c1 |
| InChI | InChI=1S/C24H26FN5O2/c1-17(32-21-8-4-6-19(25)16-21)24(31)26-20-7-3-5-18(15-20)22-9-10-23(28-27-22)30-13-11-29(2)12-14-30/h3-10,15-17H,11-14H2,1-2H3,(H,26,31) |
| InChIKey | FEWPXKJIYFYLGV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |