C26H31N5O3 — CID 43992945
2-(3-ethoxyphenoxy)-N-[4-[6-(4-methylpiperazin-1-yl)pyridazin-3-yl]phenyl]propanamide (PubChem CID 43992945) has the molecular formula C26H31N5O3 and a molecular weight of 461.57 g/mol. Its IUPAC name is 2-(3-ethoxyphenoxy)-N-[4-[6-(4-methylpiperazin-1-yl)pyridazin-3-yl]phenyl]propanamide.
| Compound Name | 2-(3-ethoxyphenoxy)-N-[4-[6-(4-methylpiperazin-1-yl)pyridazin-3-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 43992945 |
| Molecular Formula | C26H31N5O3 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | 2-(3-ethoxyphenoxy)-N-[4-[6-(4-methylpiperazin-1-yl)pyridazin-3-yl]phenyl]propanamide |
| SMILES | CCOc1cccc(OC(C)C(=O)Nc2ccc(-c3ccc(N4CCN(C)CC4)nn3)cc2)c1 |
| InChI | InChI=1S/C26H31N5O3/c1-4-33-22-6-5-7-23(18-22)34-19(2)26(32)27-21-10-8-20(9-11-21)24-12-13-25(29-28-24)31-16-14-30(3)15-17-31/h5-13,18-19H,4,14-17H2,1-3H3,(H,27,32) |
| InChIKey | PNLDHLPKMKWRNZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |