C22H22IN5O — CID 41077662
2-iodo-N-[3-[6-(4-methylpiperazin-1-yl)pyridazin-3-yl]phenyl]benzamide (PubChem CID 41077662) has the molecular formula C22H22IN5O and a molecular weight of 499.36 g/mol. Its IUPAC name is 2-iodo-N-[3-[6-(4-methylpiperazin-1-yl)pyridazin-3-yl]phenyl]benzamide.
| Compound Name | 2-iodo-N-[3-[6-(4-methylpiperazin-1-yl)pyridazin-3-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 41077662 |
| Molecular Formula | C22H22IN5O |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | 2-iodo-N-[3-[6-(4-methylpiperazin-1-yl)pyridazin-3-yl]phenyl]benzamide |
| SMILES | CN1CCN(c2ccc(-c3cccc(NC(=O)c4ccccc4I)c3)nn2)CC1 |
| InChI | InChI=1S/C22H22IN5O/c1-27-11-13-28(14-12-27)21-10-9-20(25-26-21)16-5-4-6-17(15-16)24-22(29)18-7-2-3-8-19(18)23/h2-10,15H,11-14H2,1H3,(H,24,29) |
| InChIKey | IQXAWXOYXQXYSM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|