C20H20F3N3O4 — CID 167841855
methyl N-[3-[(4-morpholin-4-ylphenyl)carbamoyl]-5-(trifluoromethyl)phenyl]carbamate (PubChem CID 167841855) has the molecular formula C20H20F3N3O4 and a molecular weight of 423.39 g/mol. Its IUPAC name is methyl N-[3-[(4-morpholin-4-ylphenyl)carbamoyl]-5-(trifluoromethyl)phenyl]carbamate.
| Compound Name | methyl N-[3-[(4-morpholin-4-ylphenyl)carbamoyl]-5-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 167841855 |
| Molecular Formula | C20H20F3N3O4 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | methyl N-[3-[(4-morpholin-4-ylphenyl)carbamoyl]-5-(trifluoromethyl)phenyl]carbamate |
| SMILES | COC(=O)Nc1cc(C(=O)Nc2ccc(N3CCOCC3)cc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H20F3N3O4/c1-29-19(28)25-16-11-13(10-14(12-16)20(21,22)23)18(27)24-15-2-4-17(5-3-15)26-6-8-30-9-7-26/h2-5,10-12H,6-9H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | VGHUTZLKQPRZQH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|