C19H15F6N3O4 — CID 2977784
N-[3,5-bis(trifluoromethyl)phenyl]-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 2977784) has the molecular formula C19H15F6N3O4 and a molecular weight of 463.33 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 2977784 |
| Molecular Formula | C19H15F6N3O4 |
| Molecular Weight | 463.33 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H15F6N3O4/c20-18(21,22)12-8-13(19(23,24)25)10-14(9-12)26-17(29)11-1-2-15(16(7-11)28(30)31)27-3-5-32-6-4-27/h1-2,7-10H,3-6H2,(H,26,29) |
| InChIKey | AQQWWJGIINFRIA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.33 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|