C19H21ClN3O2S- — CID 53351041
1-(4-acetylphenyl)-3-(4-morpholin-4-ylphenyl)thiourea chloride (PubChem CID 53351041) has the molecular formula C19H21ClN3O2S- and a molecular weight of 390.92 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-3-(4-morpholin-4-ylphenyl)thiourea chloride.
| Compound Name | 1-(4-acetylphenyl)-3-(4-morpholin-4-ylphenyl)thiourea chloride |
|---|---|
| PubChem CID | 53351041 |
| Molecular Formula | C19H21ClN3O2S- |
| Molecular Weight | 390.92 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 1-(4-acetylphenyl)-3-(4-morpholin-4-ylphenyl)thiourea chloride |
| SMILES | CC(=O)c1ccc(NC(=S)Nc2ccc(N3CCOCC3)cc2)cc1.[Cl-] |
| InChI | InChI=1S/C19H21N3O2S.ClH/c1-14(23)15-2-4-16(5-3-15)20-19(25)21-17-6-8-18(9-7-17)22-10-12-24-13-11-22;/h2-9H,10-13H2,1H3,(H2,20,21,25);1H/p-1 |
| InChIKey | XBAMBGKTHFJLRX-UHFFFAOYSA-M |
| XLogP | 0.54 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.92 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|