C21H23N3O3 — CID 108956184
N-(4-acetylphenyl)-N'-(4-pyrrolidin-1-ylphenyl)propanediamide (PubChem CID 108956184) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is N-(4-acetylphenyl)-N'-(4-pyrrolidin-1-ylphenyl)propanediamide.
| Compound Name | N-(4-acetylphenyl)-N'-(4-pyrrolidin-1-ylphenyl)propanediamide |
|---|---|
| PubChem CID | 108956184 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N-(4-acetylphenyl)-N'-(4-pyrrolidin-1-ylphenyl)propanediamide |
| SMILES | CC(=O)c1ccc(NC(=O)CC(=O)Nc2ccc(N3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C21H23N3O3/c1-15(25)16-4-6-17(7-5-16)22-20(26)14-21(27)23-18-8-10-19(11-9-18)24-12-2-3-13-24/h4-11H,2-3,12-14H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | UTRZVUMJUKOSCO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|