C23H25N3O3 — CID 110832410
(E)-N'-(4-acetylphenyl)-2-methyl-N-(4-pyrrolidin-1-ylphenyl)but-2-enediamide (PubChem CID 110832410) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is (E)-N'-(4-acetylphenyl)-2-methyl-N-(4-pyrrolidin-1-ylphenyl)but-2-enediamide.
| Compound Name | (E)-N'-(4-acetylphenyl)-2-methyl-N-(4-pyrrolidin-1-ylphenyl)but-2-enediamide |
|---|---|
| PubChem CID | 110832410 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | (E)-N'-(4-acetylphenyl)-2-methyl-N-(4-pyrrolidin-1-ylphenyl)but-2-enediamide |
| SMILES | CC(=O)c1ccc(NC(=O)/C=C(\C)C(=O)Nc2ccc(N3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C23H25N3O3/c1-16(15-22(28)24-19-7-5-18(6-8-19)17(2)27)23(29)25-20-9-11-21(12-10-20)26-13-3-4-14-26/h5-12,15H,3-4,13-14H2,1-2H3,(H,24,28)(H,25,29)/b16-15+ |
| InChIKey | KHRIVLDQGWYOGP-FOCLMDBBSA-N |
| XLogP | 4.01 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|