C19H10F7NO2 — CID 54761409
N-[3-fluoro-5-(trifluoromethyl)phenyl]-5-phenyl-2-(trifluoromethyl)furan-3-carboxamide (PubChem CID 54761409) has the molecular formula C19H10F7NO2 and a molecular weight of 417.28 g/mol. Its IUPAC name is N-[3-fluoro-5-(trifluoromethyl)phenyl]-5-phenyl-2-(trifluoromethyl)furan-3-carboxamide.
| Compound Name | N-[3-fluoro-5-(trifluoromethyl)phenyl]-5-phenyl-2-(trifluoromethyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 54761409 |
| Molecular Formula | C19H10F7NO2 |
| Molecular Weight | 417.28 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | N-[3-fluoro-5-(trifluoromethyl)phenyl]-5-phenyl-2-(trifluoromethyl)furan-3-carboxamide |
| SMILES | O=C(Nc1cc(F)cc(C(F)(F)F)c1)c1cc(-c2ccccc2)oc1C(F)(F)F |
| InChI | InChI=1S/C19H10F7NO2/c20-12-6-11(18(21,22)23)7-13(8-12)27-17(28)14-9-15(10-4-2-1-3-5-10)29-16(14)19(24,25)26/h1-9H,(H,27,28) |
| InChIKey | ROMUYAPSVMKEAQ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.28 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |