C18H12F3NO2 — CID 141114523
5-(4-phenylphenyl)-2-(trifluoromethyl)furan-3-carboxamide (PubChem CID 141114523) has the molecular formula C18H12F3NO2 and a molecular weight of 331.29 g/mol. Its IUPAC name is 5-(4-phenylphenyl)-2-(trifluoromethyl)furan-3-carboxamide.
| Compound Name | 5-(4-phenylphenyl)-2-(trifluoromethyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 141114523 |
| Molecular Formula | C18H12F3NO2 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 5-(4-phenylphenyl)-2-(trifluoromethyl)furan-3-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccc(-c3ccccc3)cc2)oc1C(F)(F)F |
| InChI | InChI=1S/C18H12F3NO2/c19-18(20,21)16-14(17(22)23)10-15(24-16)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-10H,(H2,22,23) |
| InChIKey | XXFPWGNRZXRJLW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |