C7H4F3NO4 — CID 133055417
5-carbamoyl-2-(trifluoromethyl)furan-3-carboxylic acid (PubChem CID 133055417) has the molecular formula C7H4F3NO4 and a molecular weight of 223.11 g/mol. Its IUPAC name is 5-carbamoyl-2-(trifluoromethyl)furan-3-carboxylic acid.
| Compound Name | 5-carbamoyl-2-(trifluoromethyl)furan-3-carboxylic acid |
|---|---|
| PubChem CID | 133055417 |
| Molecular Formula | C7H4F3NO4 |
| Molecular Weight | 223.11 g/mol |
| Exact Mass | 223.01 |
| IUPAC Name | 5-carbamoyl-2-(trifluoromethyl)furan-3-carboxylic acid |
| SMILES | NC(=O)c1cc(C(=O)O)c(C(F)(F)F)o1 |
| InChI | InChI=1S/C7H4F3NO4/c8-7(9,10)4-2(6(13)14)1-3(15-4)5(11)12/h1H,(H2,11,12)(H,13,14) |
| InChIKey | NCDGCCBBPPWEPM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.11 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |