C8H4F3NO5 — CID 83401835
2-oxo-6-(trifluoromethyl)-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 83401835) has the molecular formula C8H4F3NO5 and a molecular weight of 251.12 g/mol. Its IUPAC name is 2-oxo-6-(trifluoromethyl)-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-oxo-6-(trifluoromethyl)-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 83401835 |
| Molecular Formula | C8H4F3NO5 |
| Molecular Weight | 251.12 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | 2-oxo-6-(trifluoromethyl)-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)c(=O)[nH]c1C(F)(F)F |
| InChI | InChI=1S/C8H4F3NO5/c9-8(10,11)4-2(6(14)15)1-3(7(16)17)5(13)12-4/h1H,(H,12,13)(H,14,15)(H,16,17) |
| InChIKey | DORBEYQZLWXHNI-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.12 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |