C19H9Cl3F3NO3 — CID 87548006
4-chloro-2-[[5-(4-chlorophenyl)-2-(trifluoromethyl)furan-3-carbonyl]amino]benzoyl chloride (PubChem CID 87548006) has the molecular formula C19H9Cl3F3NO3 and a molecular weight of 462.64 g/mol. Its IUPAC name is 4-chloro-2-[[5-(4-chlorophenyl)-2-(trifluoromethyl)furan-3-carbonyl]amino]benzoyl chloride.
| Compound Name | 4-chloro-2-[[5-(4-chlorophenyl)-2-(trifluoromethyl)furan-3-carbonyl]amino]benzoyl chloride |
|---|---|
| PubChem CID | 87548006 |
| Molecular Formula | C19H9Cl3F3NO3 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 460.96 |
| IUPAC Name | 4-chloro-2-[[5-(4-chlorophenyl)-2-(trifluoromethyl)furan-3-carbonyl]amino]benzoyl chloride |
| SMILES | O=C(Cl)c1ccc(Cl)cc1NC(=O)c1cc(-c2ccc(Cl)cc2)oc1C(F)(F)F |
| InChI | InChI=1S/C19H9Cl3F3NO3/c20-10-3-1-9(2-4-10)15-8-13(16(29-15)19(23,24)25)18(28)26-14-7-11(21)5-6-12(14)17(22)27/h1-8H,(H,26,28) |
| InChIKey | GQZQZIVIVIIIOV-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|