C12H6ClF3O3 — CID 172500693
5-(4-chlorophenyl)-3-(trifluoromethyl)furan-2-carboxylic acid (PubChem CID 172500693) has the molecular formula C12H6ClF3O3 and a molecular weight of 290.62 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-(trifluoromethyl)furan-2-carboxylic acid.
| Compound Name | 5-(4-chlorophenyl)-3-(trifluoromethyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 172500693 |
| Molecular Formula | C12H6ClF3O3 |
| Molecular Weight | 290.62 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | 5-(4-chlorophenyl)-3-(trifluoromethyl)furan-2-carboxylic acid |
| SMILES | O=C(O)c1oc(-c2ccc(Cl)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C12H6ClF3O3/c13-7-3-1-6(2-4-7)9-5-8(12(14,15)16)10(19-9)11(17)18/h1-5H,(H,17,18) |
| InChIKey | BPAALTNALOCFSU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |