C19H13F3N2O4 — CID 90467599
4-(hydroxyamino)-2-oxo-6-phenyl-N-[3-(trifluoromethyl)phenyl]pyran-3-carboxamide (PubChem CID 90467599) has the molecular formula C19H13F3N2O4 and a molecular weight of 390.32 g/mol. Its IUPAC name is 4-(hydroxyamino)-2-oxo-6-phenyl-N-[3-(trifluoromethyl)phenyl]pyran-3-carboxamide.
| Compound Name | 4-(hydroxyamino)-2-oxo-6-phenyl-N-[3-(trifluoromethyl)phenyl]pyran-3-carboxamide |
|---|---|
| PubChem CID | 90467599 |
| Molecular Formula | C19H13F3N2O4 |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 4-(hydroxyamino)-2-oxo-6-phenyl-N-[3-(trifluoromethyl)phenyl]pyran-3-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1c(NO)cc(-c2ccccc2)oc1=O |
| InChI | InChI=1S/C19H13F3N2O4/c20-19(21,22)12-7-4-8-13(9-12)23-17(25)16-14(24-27)10-15(28-18(16)26)11-5-2-1-3-6-11/h1-10,24,27H,(H,23,25) |
| InChIKey | CFBZPOQMZNPBIX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|