C12H9F3N2O — CID 110691166
N-[3-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxamide (PubChem CID 110691166) has the molecular formula C12H9F3N2O and a molecular weight of 254.21 g/mol. Its IUPAC name is N-[3-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxamide.
| Compound Name | N-[3-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 110691166 |
| Molecular Formula | C12H9F3N2O |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | N-[3-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1cc[nH]c1 |
| InChI | InChI=1S/C12H9F3N2O/c13-12(14,15)9-2-1-3-10(6-9)17-11(18)8-4-5-16-7-8/h1-7,16H,(H,17,18) |
| InChIKey | RETSDEOKMMPVIZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |