C11H11Br2N3O2S — CID 43316443
N-(2-amino-2-sulfanylideneethyl)-N'-(2,6-dibromo-4-methylphenyl)oxamide (PubChem CID 43316443) has the molecular formula C11H11Br2N3O2S and a molecular weight of 409.10 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N'-(2,6-dibromo-4-methylphenyl)oxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N'-(2,6-dibromo-4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 43316443 |
| Molecular Formula | C11H11Br2N3O2S |
| Molecular Weight | 409.10 g/mol |
| Exact Mass | 406.89 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N'-(2,6-dibromo-4-methylphenyl)oxamide |
| SMILES | Cc1cc(Br)c(NC(=O)C(=O)NCC(N)=S)c(Br)c1 |
| InChI | InChI=1S/C11H11Br2N3O2S/c1-5-2-6(12)9(7(13)3-5)16-11(18)10(17)15-4-8(14)19/h2-3H,4H2,1H3,(H2,14,19)(H,15,17)(H,16,18) |
| InChIKey | OEBVGDVDCMKQCN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.10 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|