C13H17N3O2S — CID 43316123
N-(2-amino-2-sulfanylideneethyl)-N'-(2,4,6-trimethylphenyl)oxamide (PubChem CID 43316123) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N'-(2,4,6-trimethylphenyl)oxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N'-(2,4,6-trimethylphenyl)oxamide |
|---|---|
| PubChem CID | 43316123 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N'-(2,4,6-trimethylphenyl)oxamide |
| SMILES | Cc1cc(C)c(NC(=O)C(=O)NCC(N)=S)c(C)c1 |
| InChI | InChI=1S/C13H17N3O2S/c1-7-4-8(2)11(9(3)5-7)16-13(18)12(17)15-6-10(14)19/h4-5H,6H2,1-3H3,(H2,14,19)(H,15,17)(H,16,18) |
| InChIKey | IGRARHHGDSYUGM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|