C9H12N6O2S — CID 114388000
N-(2-amino-2-sulfanylideneethyl)-N'-(5,6-dimethyl-1,2,4-triazin-3-yl)oxamide (PubChem CID 114388000) has the molecular formula C9H12N6O2S and a molecular weight of 268.30 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N'-(5,6-dimethyl-1,2,4-triazin-3-yl)oxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N'-(5,6-dimethyl-1,2,4-triazin-3-yl)oxamide |
|---|---|
| PubChem CID | 114388000 |
| Molecular Formula | C9H12N6O2S |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N'-(5,6-dimethyl-1,2,4-triazin-3-yl)oxamide |
| SMILES | Cc1nnc(NC(=O)C(=O)NCC(N)=S)nc1C |
| InChI | InChI=1S/C9H12N6O2S/c1-4-5(2)14-15-9(12-4)13-8(17)7(16)11-3-6(10)18/h3H2,1-2H3,(H2,10,18)(H,11,16)(H,12,13,15,17) |
| InChIKey | XRLFPWYQORHQMQ-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|