C13H13N5OS — CID 114387992
4-carbamothioyl-N-(5,6-dimethyl-1,2,4-triazin-3-yl)benzamide (PubChem CID 114387992) has the molecular formula C13H13N5OS and a molecular weight of 287.35 g/mol. Its IUPAC name is 4-carbamothioyl-N-(5,6-dimethyl-1,2,4-triazin-3-yl)benzamide.
| Compound Name | 4-carbamothioyl-N-(5,6-dimethyl-1,2,4-triazin-3-yl)benzamide |
|---|---|
| PubChem CID | 114387992 |
| Molecular Formula | C13H13N5OS |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 4-carbamothioyl-N-(5,6-dimethyl-1,2,4-triazin-3-yl)benzamide |
| SMILES | Cc1nnc(NC(=O)c2ccc(C(N)=S)cc2)nc1C |
| InChI | InChI=1S/C13H13N5OS/c1-7-8(2)17-18-13(15-7)16-12(19)10-5-3-9(4-6-10)11(14)20/h3-6H,1-2H3,(H2,14,20)(H,15,16,18,19) |
| InChIKey | VUSXBWBJQJQTDO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|