C12H12N4O2 — CID 114388178
N-(5,6-dimethyl-1,2,4-triazin-3-yl)-4-hydroxybenzamide (PubChem CID 114388178) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is N-(5,6-dimethyl-1,2,4-triazin-3-yl)-4-hydroxybenzamide.
| Compound Name | N-(5,6-dimethyl-1,2,4-triazin-3-yl)-4-hydroxybenzamide |
|---|---|
| PubChem CID | 114388178 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | N-(5,6-dimethyl-1,2,4-triazin-3-yl)-4-hydroxybenzamide |
| SMILES | Cc1nnc(NC(=O)c2ccc(O)cc2)nc1C |
| InChI | InChI=1S/C12H12N4O2/c1-7-8(2)15-16-12(13-7)14-11(18)9-3-5-10(17)6-4-9/h3-6,17H,1-2H3,(H,13,14,16,18) |
| InChIKey | ADGZYYVQICXDBQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |