C13H14N4O — CID 27046784
N-(5,6-dimethyl-1,2,4-triazin-3-yl)-4-methylbenzamide (PubChem CID 27046784) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is N-(5,6-dimethyl-1,2,4-triazin-3-yl)-4-methylbenzamide.
| Compound Name | N-(5,6-dimethyl-1,2,4-triazin-3-yl)-4-methylbenzamide |
|---|---|
| PubChem CID | 27046784 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N-(5,6-dimethyl-1,2,4-triazin-3-yl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2nnc(C)c(C)n2)cc1 |
| InChI | InChI=1S/C13H14N4O/c1-8-4-6-11(7-5-8)12(18)15-13-14-9(2)10(3)16-17-13/h4-7H,1-3H3,(H,14,15,17,18) |
| InChIKey | NFFRGKCNBKORBR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |