C12H10F2N4O — CID 114387271
N-(5,6-dimethyl-1,2,4-triazin-3-yl)-2,3-difluorobenzamide (PubChem CID 114387271) has the molecular formula C12H10F2N4O and a molecular weight of 264.24 g/mol. Its IUPAC name is N-(5,6-dimethyl-1,2,4-triazin-3-yl)-2,3-difluorobenzamide.
| Compound Name | N-(5,6-dimethyl-1,2,4-triazin-3-yl)-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 114387271 |
| Molecular Formula | C12H10F2N4O |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | N-(5,6-dimethyl-1,2,4-triazin-3-yl)-2,3-difluorobenzamide |
| SMILES | Cc1nnc(NC(=O)c2cccc(F)c2F)nc1C |
| InChI | InChI=1S/C12H10F2N4O/c1-6-7(2)17-18-12(15-6)16-11(19)8-4-3-5-9(13)10(8)14/h3-5H,1-2H3,(H,15,16,18,19) |
| InChIKey | GXJVPXRJZNZEDS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |