C12H12N6O3 — CID 114389407
3-amino-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-nitrobenzamide (PubChem CID 114389407) has the molecular formula C12H12N6O3 and a molecular weight of 288.27 g/mol. Its IUPAC name is 3-amino-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-nitrobenzamide.
| Compound Name | 3-amino-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 114389407 |
| Molecular Formula | C12H12N6O3 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 3-amino-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-nitrobenzamide |
| SMILES | Cc1nnc(NC(=O)c2cccc(N)c2[N+](=O)[O-])nc1C |
| InChI | InChI=1S/C12H12N6O3/c1-6-7(2)16-17-12(14-6)15-11(19)8-4-3-5-9(13)10(8)18(20)21/h3-5H,13H2,1-2H3,(H,14,15,17,19) |
| InChIKey | OYEQWAYMFUFRLT-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 136.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|