C12H12BrN5O — CID 114386548
5-amino-2-bromo-N-(5,6-dimethyl-1,2,4-triazin-3-yl)benzamide (PubChem CID 114386548) has the molecular formula C12H12BrN5O and a molecular weight of 322.17 g/mol. Its IUPAC name is 5-amino-2-bromo-N-(5,6-dimethyl-1,2,4-triazin-3-yl)benzamide.
| Compound Name | 5-amino-2-bromo-N-(5,6-dimethyl-1,2,4-triazin-3-yl)benzamide |
|---|---|
| PubChem CID | 114386548 |
| Molecular Formula | C12H12BrN5O |
| Molecular Weight | 322.17 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 5-amino-2-bromo-N-(5,6-dimethyl-1,2,4-triazin-3-yl)benzamide |
| SMILES | Cc1nnc(NC(=O)c2cc(N)ccc2Br)nc1C |
| InChI | InChI=1S/C12H12BrN5O/c1-6-7(2)17-18-12(15-6)16-11(19)9-5-8(14)3-4-10(9)13/h3-5H,14H2,1-2H3,(H,15,16,18,19) |
| InChIKey | OYKCVKJQDIPTTJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.17 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|