C15H15BrN2O2 — CID 115297143
5-amino-2-bromo-N-(3-hydroxy-2,4-dimethylphenyl)benzamide (PubChem CID 115297143) has the molecular formula C15H15BrN2O2 and a molecular weight of 335.20 g/mol. Its IUPAC name is 5-amino-2-bromo-N-(3-hydroxy-2,4-dimethylphenyl)benzamide.
| Compound Name | 5-amino-2-bromo-N-(3-hydroxy-2,4-dimethylphenyl)benzamide |
|---|---|
| PubChem CID | 115297143 |
| Molecular Formula | C15H15BrN2O2 |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 5-amino-2-bromo-N-(3-hydroxy-2,4-dimethylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cc(N)ccc2Br)c(C)c1O |
| InChI | InChI=1S/C15H15BrN2O2/c1-8-3-6-13(9(2)14(8)19)18-15(20)11-7-10(17)4-5-12(11)16/h3-7,19H,17H2,1-2H3,(H,18,20) |
| InChIKey | WKDPGIFFYSNZLT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|