C16H18N2O2 — CID 61376332
N-(3-hydroxy-2,4-dimethylphenyl)-2-(methylamino)benzamide (PubChem CID 61376332) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is N-(3-hydroxy-2,4-dimethylphenyl)-2-(methylamino)benzamide.
| Compound Name | N-(3-hydroxy-2,4-dimethylphenyl)-2-(methylamino)benzamide |
|---|---|
| PubChem CID | 61376332 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | N-(3-hydroxy-2,4-dimethylphenyl)-2-(methylamino)benzamide |
| SMILES | CNc1ccccc1C(=O)Nc1ccc(C)c(O)c1C |
| InChI | InChI=1S/C16H18N2O2/c1-10-8-9-13(11(2)15(10)19)18-16(20)12-6-4-5-7-14(12)17-3/h4-9,17,19H,1-3H3,(H,18,20) |
| InChIKey | FSKDMGSZFXIYAR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |