C12H10BrClN4O — CID 114024558
2-bromo-4-chloro-N-(5,6-dimethyl-1,2,4-triazin-3-yl)benzamide (PubChem CID 114024558) has the molecular formula C12H10BrClN4O and a molecular weight of 341.60 g/mol. Its IUPAC name is 2-bromo-4-chloro-N-(5,6-dimethyl-1,2,4-triazin-3-yl)benzamide.
| Compound Name | 2-bromo-4-chloro-N-(5,6-dimethyl-1,2,4-triazin-3-yl)benzamide |
|---|---|
| PubChem CID | 114024558 |
| Molecular Formula | C12H10BrClN4O |
| Molecular Weight | 341.60 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | 2-bromo-4-chloro-N-(5,6-dimethyl-1,2,4-triazin-3-yl)benzamide |
| SMILES | Cc1nnc(NC(=O)c2ccc(Cl)cc2Br)nc1C |
| InChI | InChI=1S/C12H10BrClN4O/c1-6-7(2)17-18-12(15-6)16-11(19)9-4-3-8(14)5-10(9)13/h3-5H,1-2H3,(H,15,16,18,19) |
| InChIKey | JFTGDDLZHSKJDZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.60 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |