C11H9FN4O — CID 114387337
2-fluoro-3-methyl-N-(1,2,4-triazin-3-yl)benzamide (PubChem CID 114387337) has the molecular formula C11H9FN4O and a molecular weight of 232.22 g/mol. Its IUPAC name is 2-fluoro-3-methyl-N-(1,2,4-triazin-3-yl)benzamide.
| Compound Name | 2-fluoro-3-methyl-N-(1,2,4-triazin-3-yl)benzamide |
|---|---|
| PubChem CID | 114387337 |
| Molecular Formula | C11H9FN4O |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 2-fluoro-3-methyl-N-(1,2,4-triazin-3-yl)benzamide |
| SMILES | Cc1cccc(C(=O)Nc2nccnn2)c1F |
| InChI | InChI=1S/C11H9FN4O/c1-7-3-2-4-8(9(7)12)10(17)15-11-13-5-6-14-16-11/h2-6H,1H3,(H,13,15,16,17) |
| InChIKey | CXACUIGKTIFSNU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |