C10H6BrN5O3 — CID 114387365
2-bromo-3-nitro-N-(1,2,4-triazin-3-yl)benzamide (PubChem CID 114387365) has the molecular formula C10H6BrN5O3 and a molecular weight of 324.09 g/mol. Its IUPAC name is 2-bromo-3-nitro-N-(1,2,4-triazin-3-yl)benzamide.
| Compound Name | 2-bromo-3-nitro-N-(1,2,4-triazin-3-yl)benzamide |
|---|---|
| PubChem CID | 114387365 |
| Molecular Formula | C10H6BrN5O3 |
| Molecular Weight | 324.09 g/mol |
| Exact Mass | 322.97 |
| IUPAC Name | 2-bromo-3-nitro-N-(1,2,4-triazin-3-yl)benzamide |
| SMILES | O=C(Nc1nccnn1)c1cccc([N+](=O)[O-])c1Br |
| InChI | InChI=1S/C10H6BrN5O3/c11-8-6(2-1-3-7(8)16(18)19)9(17)14-10-12-4-5-13-15-10/h1-5H,(H,12,14,15,17) |
| InChIKey | AZANTOJDKRLSSR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 110.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.09 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|