C11H11N5O — CID 114389471
2-(methylamino)-N-(1,2,4-triazin-3-yl)benzamide (PubChem CID 114389471) has the molecular formula C11H11N5O and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-(methylamino)-N-(1,2,4-triazin-3-yl)benzamide.
| Compound Name | 2-(methylamino)-N-(1,2,4-triazin-3-yl)benzamide |
|---|---|
| PubChem CID | 114389471 |
| Molecular Formula | C11H11N5O |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 2-(methylamino)-N-(1,2,4-triazin-3-yl)benzamide |
| SMILES | CNc1ccccc1C(=O)Nc1nccnn1 |
| InChI | InChI=1S/C11H11N5O/c1-12-9-5-3-2-4-8(9)10(17)15-11-13-6-7-14-16-11/h2-7,12H,1H3,(H,13,15,16,17) |
| InChIKey | ZVSZKQWYSXLUTO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |