C13H12BrN3O4 — CID 106551661
2-bromo-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]-3-nitrobenzamide (PubChem CID 106551661) has the molecular formula C13H12BrN3O4 and a molecular weight of 354.16 g/mol. Its IUPAC name is 2-bromo-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]-3-nitrobenzamide.
| Compound Name | 2-bromo-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 106551661 |
| Molecular Formula | C13H12BrN3O4 |
| Molecular Weight | 354.16 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 2-bromo-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]-3-nitrobenzamide |
| SMILES | Cc1cnc(C(C)NC(=O)c2cccc([N+](=O)[O-])c2Br)o1 |
| InChI | InChI=1S/C13H12BrN3O4/c1-7-6-15-13(21-7)8(2)16-12(18)9-4-3-5-10(11(9)14)17(19)20/h3-6,8H,1-2H3,(H,16,18) |
| InChIKey | ZQMMZXZPTXLKGK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.16 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|