C13H12ClFN2O2 — CID 103949119
5-chloro-2-fluoro-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]benzamide (PubChem CID 103949119) has the molecular formula C13H12ClFN2O2 and a molecular weight of 282.70 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]benzamide.
| Compound Name | 5-chloro-2-fluoro-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 103949119 |
| Molecular Formula | C13H12ClFN2O2 |
| Molecular Weight | 282.70 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 5-chloro-2-fluoro-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]benzamide |
| SMILES | Cc1cnc(C(C)NC(=O)c2cc(Cl)ccc2F)o1 |
| InChI | InChI=1S/C13H12ClFN2O2/c1-7-6-16-13(19-7)8(2)17-12(18)10-5-9(14)3-4-11(10)15/h3-6,8H,1-2H3,(H,17,18) |
| InChIKey | PUBMWMGVUITVBP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.70 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |