C9H13ClN2O2 — CID 106388094
2-chloro-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]propanamide (PubChem CID 106388094) has the molecular formula C9H13ClN2O2 and a molecular weight of 216.67 g/mol. Its IUPAC name is 2-chloro-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]propanamide.
| Compound Name | 2-chloro-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 106388094 |
| Molecular Formula | C9H13ClN2O2 |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 2-chloro-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]propanamide |
| SMILES | Cc1cnc(C(C)NC(=O)C(C)Cl)o1 |
| InChI | InChI=1S/C9H13ClN2O2/c1-5-4-11-9(14-5)7(3)12-8(13)6(2)10/h4,6-7H,1-3H3,(H,12,13) |
| InChIKey | CZBIRSUEPFPVJD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|