C9H11N3O2 — CID 104920659
2-cyano-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]acetamide (PubChem CID 104920659) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 2-cyano-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]acetamide.
| Compound Name | 2-cyano-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 104920659 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2-cyano-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]acetamide |
| SMILES | Cc1cnc(C(C)NC(=O)CC#N)o1 |
| InChI | InChI=1S/C9H11N3O2/c1-6-5-11-9(14-6)7(2)12-8(13)3-4-10/h5,7H,3H2,1-2H3,(H,12,13) |
| InChIKey | PVFFCZNKESQQDS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |