C11H17BrN2O2 — CID 106388099
5-bromo-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]pentanamide (PubChem CID 106388099) has the molecular formula C11H17BrN2O2 and a molecular weight of 289.17 g/mol. Its IUPAC name is 5-bromo-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]pentanamide.
| Compound Name | 5-bromo-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 106388099 |
| Molecular Formula | C11H17BrN2O2 |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 5-bromo-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]pentanamide |
| SMILES | Cc1cnc(C(C)NC(=O)CCCCBr)o1 |
| InChI | InChI=1S/C11H17BrN2O2/c1-8-7-13-11(16-8)9(2)14-10(15)5-3-4-6-12/h7,9H,3-6H2,1-2H3,(H,14,15) |
| InChIKey | QPZSECKXUCPRRE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|