C15H19N3O3 — CID 106387462
3-(4-aminophenoxy)-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]propanamide (PubChem CID 106387462) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 3-(4-aminophenoxy)-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]propanamide.
| Compound Name | 3-(4-aminophenoxy)-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 106387462 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 3-(4-aminophenoxy)-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]propanamide |
| SMILES | Cc1cnc(C(C)NC(=O)CCOc2ccc(N)cc2)o1 |
| InChI | InChI=1S/C15H19N3O3/c1-10-9-17-15(21-10)11(2)18-14(19)7-8-20-13-5-3-12(16)4-6-13/h3-6,9,11H,7-8,16H2,1-2H3,(H,18,19) |
| InChIKey | MSKXNRJWYHZRFR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|