C13H13ClN2O3 — CID 103950224
3-chloro-4-hydroxy-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]benzamide (PubChem CID 103950224) has the molecular formula C13H13ClN2O3 and a molecular weight of 280.71 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]benzamide.
| Compound Name | 3-chloro-4-hydroxy-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 103950224 |
| Molecular Formula | C13H13ClN2O3 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 3-chloro-4-hydroxy-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]benzamide |
| SMILES | Cc1cnc(C(C)NC(=O)c2ccc(O)c(Cl)c2)o1 |
| InChI | InChI=1S/C13H13ClN2O3/c1-7-6-15-13(19-7)8(2)16-12(18)9-3-4-11(17)10(14)5-9/h3-6,8,17H,1-2H3,(H,16,18) |
| InChIKey | FKHUBRMKQSRHGW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |