C15H15N3O2 — CID 103948958
N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]-1H-indole-5-carboxamide (PubChem CID 103948958) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]-1H-indole-5-carboxamide.
| Compound Name | N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 103948958 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]-1H-indole-5-carboxamide |
| SMILES | Cc1cnc(C(C)NC(=O)c2ccc3[nH]ccc3c2)o1 |
| InChI | InChI=1S/C15H15N3O2/c1-9-8-17-15(20-9)10(2)18-14(19)12-3-4-13-11(7-12)5-6-16-13/h3-8,10,16H,1-2H3,(H,18,19) |
| InChIKey | QTKUWTIAHUCAOH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |