3-bromo-2-(1,2,4-triazin-3-ylcarbamoylamino)benzoic acid

C11H8BrN5O3 — CID 114388639

IUPAC3-bromo-2-(1,2,4-triazin-3-ylcarbamoylamino)benzoic acid
SMILESO=C(Nc1nccnn1)Nc1c(Br)cccc1C(=O)O
InChIInChI=1S/C11H8BrN5O3/c12-7-3-1-2-6(9(18)19)8(7)15-11(20)16-10-13-4-5-14-17-10/h1-5H,(H,18,19)(H2,13,15,16,17,20)
InChIKeyLMGUJKRPGGZOCS-UHFFFAOYSA-N
MW338.12 g/mol
LogP1.98
Rot. Bonds3

About 3-bromo-2-(1,2,4-triazin-3-ylcarbamoylamino)benzoic acid

3-bromo-2-(1,2,4-triazin-3-ylcarbamoylamino)benzoic acid (PubChem CID 114388639) has the molecular formula C11H8BrN5O3 and a molecular weight of 338.12 g/mol. Its IUPAC name is 3-bromo-2-(1,2,4-triazin-3-ylcarbamoylamino)benzoic acid.

Molecular Properties

Compound Name3-bromo-2-(1,2,4-triazin-3-ylcarbamoylamino)benzoic acid
PubChem CID114388639
Molecular FormulaC11H8BrN5O3
Molecular Weight338.12 g/mol
Exact Mass336.98
IUPAC Name3-bromo-2-(1,2,4-triazin-3-ylcarbamoylamino)benzoic acid
SMILESO=C(Nc1nccnn1)Nc1c(Br)cccc1C(=O)O
InChIInChI=1S/C11H8BrN5O3/c12-7-3-1-2-6(9(18)19)8(7)15-11(20)16-10-13-4-5-14-17-10/h1-5H,(H,18,19)(H2,13,15,16,17,20)
InChIKeyLMGUJKRPGGZOCS-UHFFFAOYSA-N
XLogP1.98
TPSA117.10 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500338.12
LogP ≤ 51.98
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 3-bromo-2-(1,2,4-triazin-3-ylcarbamoylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-bromo-2-(1,2,4-triazin-3-ylcarbamoylamino)benzoic acid?
The IUPAC name of 3-bromo-2-(1,2,4-triazin-3-ylcarbamoylamino)benzoic acid (CID 114388639) is 3-bromo-2-(1,2,4-triazin-3-ylcarbamoylamino)benzoic acid.
What is the SMILES notation for 3-bromo-2-(1,2,4-triazin-3-ylcarbamoylamino)benzoic acid?
The canonical SMILES for 3-bromo-2-(1,2,4-triazin-3-ylcarbamoylamino)benzoic acid is O=C(Nc1nccnn1)Nc1c(Br)cccc1C(=O)O.
What is the InChIKey of 3-bromo-2-(1,2,4-triazin-3-ylcarbamoylamino)benzoic acid?
The InChIKey is LMGUJKRPGGZOCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8BrN5O3/c12-7-3-1-2-6(9(18)19)8(7)15-11(20)16-10-13-4-5-14-17-10/h1-5H,(H,18,19)(H2,13,15,16,17,20).
What are the key properties of 3-bromo-2-(1,2,4-triazin-3-ylcarbamoylamino)benzoic acid?
3-bromo-2-(1,2,4-triazin-3-ylcarbamoylamino)benzoic acid has a molecular weight of 338.12 g/mol, XLogP of 1.98, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-(1,2,4-triazin-3-ylcarbamoylamino)benzoic acid is sourced from PubChem (CID 114388639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).