C11H7Cl2N5O3 — CID 114388674
3,5-dichloro-4-(1,2,4-triazin-3-ylcarbamoylamino)benzoic acid (PubChem CID 114388674) has the molecular formula C11H7Cl2N5O3 and a molecular weight of 328.12 g/mol. Its IUPAC name is 3,5-dichloro-4-(1,2,4-triazin-3-ylcarbamoylamino)benzoic acid.
| Compound Name | 3,5-dichloro-4-(1,2,4-triazin-3-ylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 114388674 |
| Molecular Formula | C11H7Cl2N5O3 |
| Molecular Weight | 328.12 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 3,5-dichloro-4-(1,2,4-triazin-3-ylcarbamoylamino)benzoic acid |
| SMILES | O=C(Nc1nccnn1)Nc1c(Cl)cc(C(=O)O)cc1Cl |
| InChI | InChI=1S/C11H7Cl2N5O3/c12-6-3-5(9(19)20)4-7(13)8(6)16-11(21)17-10-14-1-2-15-18-10/h1-4H,(H,19,20)(H2,14,16,17,18,21) |
| InChIKey | QIYBEVXQYRNHAB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.12 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |