C12H11N5O3 — CID 114388727
3-[(1,2,4-triazin-3-ylcarbamoylamino)methyl]benzoic acid (PubChem CID 114388727) has the molecular formula C12H11N5O3 and a molecular weight of 273.25 g/mol. Its IUPAC name is 3-[(1,2,4-triazin-3-ylcarbamoylamino)methyl]benzoic acid.
| Compound Name | 3-[(1,2,4-triazin-3-ylcarbamoylamino)methyl]benzoic acid |
|---|---|
| PubChem CID | 114388727 |
| Molecular Formula | C12H11N5O3 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 3-[(1,2,4-triazin-3-ylcarbamoylamino)methyl]benzoic acid |
| SMILES | O=C(NCc1cccc(C(=O)O)c1)Nc1nccnn1 |
| InChI | InChI=1S/C12H11N5O3/c18-10(19)9-3-1-2-8(6-9)7-14-12(20)16-11-13-4-5-15-17-11/h1-6H,7H2,(H,18,19)(H2,13,14,16,17,20) |
| InChIKey | GDIOLBDCZJYXJE-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |