C12H11N5O2 — CID 114389178
1-(3-acetylphenyl)-3-(1,2,4-triazin-3-yl)urea (PubChem CID 114389178) has the molecular formula C12H11N5O2 and a molecular weight of 257.25 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-(1,2,4-triazin-3-yl)urea.
| Compound Name | 1-(3-acetylphenyl)-3-(1,2,4-triazin-3-yl)urea |
|---|---|
| PubChem CID | 114389178 |
| Molecular Formula | C12H11N5O2 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 1-(3-acetylphenyl)-3-(1,2,4-triazin-3-yl)urea |
| SMILES | CC(=O)c1cccc(NC(=O)Nc2nccnn2)c1 |
| InChI | InChI=1S/C12H11N5O2/c1-8(18)9-3-2-4-10(7-9)15-12(19)16-11-13-5-6-14-17-11/h2-7H,1H3,(H2,13,15,16,17,19) |
| InChIKey | HVUPNLAFYXBVSM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |