C11H10N4O2 — CID 108895771
1-(3-hydroxyphenyl)-3-pyrimidin-2-ylurea (PubChem CID 108895771) has the molecular formula C11H10N4O2 and a molecular weight of 230.23 g/mol. Its IUPAC name is 1-(3-hydroxyphenyl)-3-pyrimidin-2-ylurea.
| Compound Name | 1-(3-hydroxyphenyl)-3-pyrimidin-2-ylurea |
|---|---|
| PubChem CID | 108895771 |
| Molecular Formula | C11H10N4O2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 1-(3-hydroxyphenyl)-3-pyrimidin-2-ylurea |
| SMILES | O=C(Nc1cccc(O)c1)Nc1ncccn1 |
| InChI | InChI=1S/C11H10N4O2/c16-9-4-1-3-8(7-9)14-11(17)15-10-12-5-2-6-13-10/h1-7,16H,(H2,12,13,14,15,17) |
| InChIKey | IRBIVVGPWLUOIN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |