C14H12N4O3 — CID 115340564
(E)-3-[3-(pyrimidin-2-ylcarbamoylamino)phenyl]prop-2-enoic acid (PubChem CID 115340564) has the molecular formula C14H12N4O3 and a molecular weight of 284.28 g/mol. Its IUPAC name is (E)-3-[3-(pyrimidin-2-ylcarbamoylamino)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-(pyrimidin-2-ylcarbamoylamino)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 115340564 |
| Molecular Formula | C14H12N4O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | (E)-3-[3-(pyrimidin-2-ylcarbamoylamino)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(NC(=O)Nc2ncccn2)c1 |
| InChI | InChI=1S/C14H12N4O3/c19-12(20)6-5-10-3-1-4-11(9-10)17-14(21)18-13-15-7-2-8-16-13/h1-9H,(H,19,20)(H2,15,16,17,18,21)/b6-5+ |
| InChIKey | VSSPRLGYKTYCBB-AATRIKPKSA-N |
| XLogP | 2.22 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|