C13H13N5O3 — CID 115341018
(E)-3-[3-[(2-methyl-1,2,4-triazol-3-yl)carbamoylamino]phenyl]prop-2-enoic acid (PubChem CID 115341018) has the molecular formula C13H13N5O3 and a molecular weight of 287.28 g/mol. Its IUPAC name is (E)-3-[3-[(2-methyl-1,2,4-triazol-3-yl)carbamoylamino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[(2-methyl-1,2,4-triazol-3-yl)carbamoylamino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 115341018 |
| Molecular Formula | C13H13N5O3 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | (E)-3-[3-[(2-methyl-1,2,4-triazol-3-yl)carbamoylamino]phenyl]prop-2-enoic acid |
| SMILES | Cn1ncnc1NC(=O)Nc1cccc(/C=C/C(=O)O)c1 |
| InChI | InChI=1S/C13H13N5O3/c1-18-12(14-8-15-18)17-13(21)16-10-4-2-3-9(7-10)5-6-11(19)20/h2-8H,1H3,(H,19,20)(H2,14,15,16,17,21)/b6-5+ |
| InChIKey | LWAPEXWSJOUNTJ-AATRIKPKSA-N |
| XLogP | 1.56 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|