C12H8Cl2N2O3S — CID 82833189
3,5-dichloro-4-(thiophen-3-ylcarbamoylamino)benzoic acid (PubChem CID 82833189) has the molecular formula C12H8Cl2N2O3S and a molecular weight of 331.18 g/mol. Its IUPAC name is 3,5-dichloro-4-(thiophen-3-ylcarbamoylamino)benzoic acid.
| Compound Name | 3,5-dichloro-4-(thiophen-3-ylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 82833189 |
| Molecular Formula | C12H8Cl2N2O3S |
| Molecular Weight | 331.18 g/mol |
| Exact Mass | 329.96 |
| IUPAC Name | 3,5-dichloro-4-(thiophen-3-ylcarbamoylamino)benzoic acid |
| SMILES | O=C(Nc1ccsc1)Nc1c(Cl)cc(C(=O)O)cc1Cl |
| InChI | InChI=1S/C12H8Cl2N2O3S/c13-8-3-6(11(17)18)4-9(14)10(8)16-12(19)15-7-1-2-20-5-7/h1-5H,(H,17,18)(H2,15,16,19) |
| InChIKey | JSLGBCOXXCEXMP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.18 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |