C11H8FN5O3 — CID 114388573
2-fluoro-6-(1,2,4-triazin-3-ylcarbamoylamino)benzoic acid (PubChem CID 114388573) has the molecular formula C11H8FN5O3 and a molecular weight of 277.21 g/mol. Its IUPAC name is 2-fluoro-6-(1,2,4-triazin-3-ylcarbamoylamino)benzoic acid.
| Compound Name | 2-fluoro-6-(1,2,4-triazin-3-ylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 114388573 |
| Molecular Formula | C11H8FN5O3 |
| Molecular Weight | 277.21 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 2-fluoro-6-(1,2,4-triazin-3-ylcarbamoylamino)benzoic acid |
| SMILES | O=C(Nc1nccnn1)Nc1cccc(F)c1C(=O)O |
| InChI | InChI=1S/C11H8FN5O3/c12-6-2-1-3-7(8(6)9(18)19)15-11(20)16-10-13-4-5-14-17-10/h1-5H,(H,18,19)(H2,13,15,16,17,20) |
| InChIKey | HVKJZJMIUYZZMC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.21 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |